C23H34O2 — CID 67472832
4-(4b,8-dimethyl-2-propan-2-yl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-3-yl)butanoic acid (PubChem CID 67472832) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is 4-(4b,8-dimethyl-2-propan-2-yl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-3-yl)butanoic acid.
| Compound Name | 4-(4b,8-dimethyl-2-propan-2-yl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-3-yl)butanoic acid |
|---|---|
| PubChem CID | 67472832 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 4-(4b,8-dimethyl-2-propan-2-yl-6,7,8,8a,9,10-hexahydro-5H-phenanthren-3-yl)butanoic acid |
| SMILES | CC(C)c1cc2c(cc1CCCC(=O)O)C1(C)CCCC(C)C1CC2 |
| InChI | InChI=1S/C23H34O2/c1-15(2)19-13-18-10-11-20-16(3)7-6-12-23(20,4)21(18)14-17(19)8-5-9-22(24)25/h13-16,20H,5-12H2,1-4H3,(H,24,25) |
| InChIKey | WBFAPIHZKYIFHG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |