About 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one
5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one (PubChem CID 67472985) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one |
| PubChem CID | 67472985 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one |
| SMILES | Cc1[nH]cc(C(C)O)c(=O)c1C |
| InChI | InChI=1S/C9H13NO2/c1-5-6(2)10-4-8(7(3)11)9(5)12/h4,7,11H,1-3H3,(H,10,12) |
| InChIKey | ZSVIFDZXFMZHDN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one?
The IUPAC name of 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one (CID 67472985) is 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one.
What is the SMILES notation for 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one?
The canonical SMILES for 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one is Cc1[nH]cc(C(C)O)c(=O)c1C.
What is the InChIKey of 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one?
The InChIKey is ZSVIFDZXFMZHDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2/c1-5-6(2)10-4-8(7(3)11)9(5)12/h4,7,11H,1-3H3,(H,10,12).
What are the key properties of 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one?
5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one has a molecular weight of 167.21 g/mol, XLogP of 1.05, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-hydroxyethyl)-2,3-dimethyl-1H-pyridin-4-one is sourced from PubChem (CID 67472985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).