C18H23NO — CID 6747304
4-methyl-N-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]benzamide (PubChem CID 6747304) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-methyl-N-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]benzamide.
| Compound Name | 4-methyl-N-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]benzamide |
|---|---|
| PubChem CID | 6747304 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 4-methyl-N-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]benzamide |
| SMILES | Cc1ccc(C(=O)/N=C2\C[C@@H]3CC[C@@]2(C)C3(C)C)cc1 |
| InChI | InChI=1S/C18H23NO/c1-12-5-7-13(8-6-12)16(20)19-15-11-14-9-10-18(15,4)17(14,2)3/h5-8,14H,9-11H2,1-4H3/b19-15+/t14-,18+/m0/s1 |
| InChIKey | QHRWIYCBIBBJQB-POJSKFFVSA-N |
| XLogP | 4.42 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|