C13H10Cl2N2O3 — CID 67474125
2-[(2,5-dichlorophenyl)methoxy]-4-nitroaniline (PubChem CID 67474125) has the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.14 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)methoxy]-4-nitroaniline.
| Compound Name | 2-[(2,5-dichlorophenyl)methoxy]-4-nitroaniline |
|---|---|
| PubChem CID | 67474125 |
| Molecular Formula | C13H10Cl2N2O3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)methoxy]-4-nitroaniline |
| SMILES | Nc1ccc([N+](=O)[O-])cc1OCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H10Cl2N2O3/c14-9-1-3-11(15)8(5-9)7-20-13-6-10(17(18)19)2-4-12(13)16/h1-6H,7,16H2 |
| InChIKey | XIXQVWJERIJNHW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|