C33H66O11Si3 — CID 67475000
dibutyl 2-[[(3R,6S)-6-(6-methoxy-6-oxohexoxy)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl]propanedioate (PubChem CID 67475000) has the molecular formula C33H66O11Si3 and a molecular weight of 723.14 g/mol. Its IUPAC name is dibutyl 2-[[(3R,6S)-6-(6-methoxy-6-oxohexoxy)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl]propanedioate.
| Compound Name | dibutyl 2-[[(3R,6S)-6-(6-methoxy-6-oxohexoxy)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl]propanedioate |
|---|---|
| PubChem CID | 67475000 |
| Molecular Formula | C33H66O11Si3 |
| Molecular Weight | 723.14 g/mol |
| Exact Mass | 722.39 |
| IUPAC Name | dibutyl 2-[[(3R,6S)-6-(6-methoxy-6-oxohexoxy)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methyl]propanedioate |
| SMILES | CCCCOC(=O)C(CC1O[C@H](OCCCCCC(=O)OC)C(O[Si](C)(C)C)C(O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)C(=O)OCCCC |
| InChI | InChI=1S/C33H66O11Si3/c1-13-15-21-38-31(35)25(32(36)39-22-16-14-2)24-26-28(42-45(4,5)6)29(43-46(7,8)9)30(44-47(10,11)12)33(41-26)40-23-19-17-18-20-27(34)37-3/h25-26,28-30,33H,13-24H2,1-12H3/t26?,28-,29?,30?,33+/m1/s1 |
| InChIKey | BHHNJUAEKSBUQC-NZZLLMGASA-N |
| XLogP | 6.81 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.14 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|