C19H26N2O4 — CID 67475339
(6aS)-3-butoxy-2,6-dimethoxy-8-methylidene-6,6a,7,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-11-one (PubChem CID 67475339) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is (6aS)-3-butoxy-2,6-dimethoxy-8-methylidene-6,6a,7,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-11-one.
| Compound Name | (6aS)-3-butoxy-2,6-dimethoxy-8-methylidene-6,6a,7,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-11-one |
|---|---|
| PubChem CID | 67475339 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (6aS)-3-butoxy-2,6-dimethoxy-8-methylidene-6,6a,7,9-tetrahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-11-one |
| SMILES | C=C1C[C@H]2C(OC)Nc3cc(OCCCC)c(OC)cc3C(=O)N2C1 |
| InChI | InChI=1S/C19H26N2O4/c1-5-6-7-25-17-10-14-13(9-16(17)23-3)19(22)21-11-12(2)8-15(21)18(20-14)24-4/h9-10,15,18,20H,2,5-8,11H2,1,3-4H3/t15-,18?/m0/s1 |
| InChIKey | KSCHFJCEGFUTSS-BUSXIPJBSA-N |
| XLogP | 3.04 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|