C27H33FO2Si — CID 67475419
[(1S,2R)-1-(5-fluorocyclohexa-2,4-dien-1-yl)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]cyclopropyl]methanol (PubChem CID 67475419) has the molecular formula C27H33FO2Si and a molecular weight of 436.64 g/mol. Its IUPAC name is [(1S,2R)-1-(5-fluorocyclohexa-2,4-dien-1-yl)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]cyclopropyl]methanol.
| Compound Name | [(1S,2R)-1-(5-fluorocyclohexa-2,4-dien-1-yl)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 67475419 |
| Molecular Formula | C27H33FO2Si |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [(1S,2R)-1-(5-fluorocyclohexa-2,4-dien-1-yl)-2-[3-[hydroxy(diphenyl)silyl]-3-methylbutyl]cyclopropyl]methanol |
| SMILES | CC(C)(CC[C@@H]1C[C@@]1(CO)C1C=CC=C(F)C1)[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H33FO2Si/c1-26(2,17-16-22-19-27(22,20-29)21-10-9-11-23(28)18-21)31(30,24-12-5-3-6-13-24)25-14-7-4-8-15-25/h3-15,21-22,29-30H,16-20H2,1-2H3/t21?,22-,27-/m1/s1 |
| InChIKey | CYBVIUBYDXPIBW-WUYOWBIRSA-N |
| XLogP | 4.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|