C44H81NO2 — CID 67476009
2-[[5,5-bis[(9Z,12Z)-octadeca-9,12-dienyl]oxolan-2-yl]methyl-methylamino]ethanol (PubChem CID 67476009) has the molecular formula C44H81NO2 and a molecular weight of 656.14 g/mol. Its IUPAC name is 2-[[5,5-bis[(9Z,12Z)-octadeca-9,12-dienyl]oxolan-2-yl]methyl-methylamino]ethanol.
| Compound Name | 2-[[5,5-bis[(9Z,12Z)-octadeca-9,12-dienyl]oxolan-2-yl]methyl-methylamino]ethanol |
|---|---|
| PubChem CID | 67476009 |
| Molecular Formula | C44H81NO2 |
| Molecular Weight | 656.14 g/mol |
| Exact Mass | 655.63 |
| IUPAC Name | 2-[[5,5-bis[(9Z,12Z)-octadeca-9,12-dienyl]oxolan-2-yl]methyl-methylamino]ethanol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)CCC(CN(C)CCO)O1 |
| InChI | InChI=1S/C44H81NO2/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-37-44(39-36-43(47-44)42-45(3)40-41-46)38-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21,43,46H,4-11,16-17,22-42H2,1-3H3/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | AEJNCFIKWFVXEO-QYCRHRGJSA-N |
| XLogP | 13.24 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.14 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|