About 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole
3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole (PubChem CID 67476026) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole.
Molecular Properties
| Compound Name | 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole |
| PubChem CID | 67476026 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole |
| SMILES | C=C1C(C(C)C)=CNN1C(C)C |
| InChI | InChI=1S/C10H18N2/c1-7(2)10-6-11-12(8(3)4)9(10)5/h6-8,11H,5H2,1-4H3 |
| InChIKey | KHVXZVYBJZOVBG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole?
The IUPAC name of 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole (CID 67476026) is 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole.
What is the SMILES notation for 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole?
The canonical SMILES for 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole is C=C1C(C(C)C)=CNN1C(C)C.
What is the InChIKey of 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole?
The InChIKey is KHVXZVYBJZOVBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-7(2)10-6-11-12(8(3)4)9(10)5/h6-8,11H,5H2,1-4H3.
What are the key properties of 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole?
3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole has a molecular weight of 166.27 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidene-2,4-di(propan-2-yl)-1H-pyrazole is sourced from PubChem (CID 67476026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).