C26H20F2N6O4 — CID 67476284
1-[(3,4-difluorophenyl)methyl]-N-[3-[4-(ethylamino)-3-nitroquinolin-6-yl]prop-2-ynyl]-6-oxopyrimidine-5-carboxamide (PubChem CID 67476284) has the molecular formula C26H20F2N6O4 and a molecular weight of 518.48 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-N-[3-[4-(ethylamino)-3-nitroquinolin-6-yl]prop-2-ynyl]-6-oxopyrimidine-5-carboxamide.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-N-[3-[4-(ethylamino)-3-nitroquinolin-6-yl]prop-2-ynyl]-6-oxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 67476284 |
| Molecular Formula | C26H20F2N6O4 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-N-[3-[4-(ethylamino)-3-nitroquinolin-6-yl]prop-2-ynyl]-6-oxopyrimidine-5-carboxamide |
| SMILES | CCNc1c([N+](=O)[O-])cnc2ccc(C#CCNC(=O)c3cncn(Cc4ccc(F)c(F)c4)c3=O)cc12 |
| InChI | InChI=1S/C26H20F2N6O4/c1-2-30-24-18-10-16(6-8-22(18)32-13-23(24)34(37)38)4-3-9-31-25(35)19-12-29-15-33(26(19)36)14-17-5-7-20(27)21(28)11-17/h5-8,10-13,15H,2,9,14H2,1H3,(H,30,32)(H,31,35) |
| InChIKey | SDUDMAPRMADPLY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|