C21H28N2O6 — CID 67476401
4-O-benzyl 1-O-tert-butyl 6-O-methyl (3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4,6-tricarboxylate (PubChem CID 67476401) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is 4-O-benzyl 1-O-tert-butyl 6-O-methyl (3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4,6-tricarboxylate.
| Compound Name | 4-O-benzyl 1-O-tert-butyl 6-O-methyl (3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4,6-tricarboxylate |
|---|---|
| PubChem CID | 67476401 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 4-O-benzyl 1-O-tert-butyl 6-O-methyl (3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-1,4,6-tricarboxylate |
| SMILES | COC(=O)[C@@H]1CN(C(=O)OCc2ccccc2)[C@@H]2CCN(C(=O)OC(C)(C)C)[C@@H]21 |
| InChI | InChI=1S/C21H28N2O6/c1-21(2,3)29-20(26)22-11-10-16-17(22)15(18(24)27-4)12-23(16)19(25)28-13-14-8-6-5-7-9-14/h5-9,15-17H,10-13H2,1-4H3/t15-,16-,17-/m1/s1 |
| InChIKey | FMBMZOLUMUVFFI-BRWVUGGUSA-N |
| XLogP | 2.81 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|