C42H24N10S3 — CID 67476601
10-[7,11-di(phenothiazin-10-yl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]phenothiazine (PubChem CID 67476601) has the molecular formula C42H24N10S3 and a molecular weight of 764.93 g/mol. Its IUPAC name is 10-[7,11-di(phenothiazin-10-yl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]phenothiazine.
| Compound Name | 10-[7,11-di(phenothiazin-10-yl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]phenothiazine |
|---|---|
| PubChem CID | 67476601 |
| Molecular Formula | C42H24N10S3 |
| Molecular Weight | 764.93 g/mol |
| Exact Mass | 764.13 |
| IUPAC Name | 10-[7,11-di(phenothiazin-10-yl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaen-3-yl]phenothiazine |
| SMILES | c1ccc2c(c1)Sc1ccccc1N2C1=NC2=NC(N3c4ccccc4Sc4ccccc43)=NC3=NC(N4c5ccccc5Sc5ccccc54)=NC(=N1)N23 |
| InChI | InChI=1S/C42H24N10S3/c1-7-19-31-25(13-1)49(26-14-2-8-20-32(26)53-31)37-43-40-45-38(50-27-15-3-9-21-33(27)54-34-22-10-4-16-28(34)50)47-42-48-39(46-41(44-37)52(40)42)51-29-17-5-11-23-35(29)55-36-24-12-6-18-30(36)51/h1-24H |
| InChIKey | SYVRZTQGGDAMJW-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 87.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.93 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |