C27H18F3N7 — CID 67476609
3,7,11-tris(4-fluoro-3-methylphenyl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene (PubChem CID 67476609) has the molecular formula C27H18F3N7 and a molecular weight of 497.48 g/mol. Its IUPAC name is 3,7,11-tris(4-fluoro-3-methylphenyl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene.
| Compound Name | 3,7,11-tris(4-fluoro-3-methylphenyl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 67476609 |
| Molecular Formula | C27H18F3N7 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 3,7,11-tris(4-fluoro-3-methylphenyl)-2,4,6,8,10,12,13-heptazatricyclo[7.3.1.05,13]trideca-1(12),2,4,6,8,10-hexaene |
| SMILES | Cc1cc(C2=NC3=NC(c4ccc(F)c(C)c4)=NC4=NC(c5ccc(F)c(C)c5)=NC(=N2)N34)ccc1F |
| InChI | InChI=1S/C27H18F3N7/c1-13-10-16(4-7-19(13)28)22-31-25-33-23(17-5-8-20(29)14(2)11-17)35-27-36-24(34-26(32-22)37(25)27)18-6-9-21(30)15(3)12-18/h4-12H,1-3H3 |
| InChIKey | NCZORBSCYVMHOE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 77.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |