C10H12N2O2 — CID 67476667
1-oxo-5,6,7,8-tetrahydro-2H-isoquinoline-3-carboxamide (PubChem CID 67476667) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 1-oxo-5,6,7,8-tetrahydro-2H-isoquinoline-3-carboxamide.
| Compound Name | 1-oxo-5,6,7,8-tetrahydro-2H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 67476667 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 1-oxo-5,6,7,8-tetrahydro-2H-isoquinoline-3-carboxamide |
| SMILES | NC(=O)c1cc2c(c(=O)[nH]1)CCCC2 |
| InChI | InChI=1S/C10H12N2O2/c11-9(13)8-5-6-3-1-2-4-7(6)10(14)12-8/h5H,1-4H2,(H2,11,13)(H,12,14) |
| InChIKey | LNDXKZSPTVHXNC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |