C44H60Br2O8 — CID 67476758
2,8-dibromo-6,6,12,12-tetrakis[2-(2-ethoxyethoxy)ethyl]indeno[1,2-b]fluorene (PubChem CID 67476758) has the molecular formula C44H60Br2O8 and a molecular weight of 876.76 g/mol. Its IUPAC name is 2,8-dibromo-6,6,12,12-tetrakis[2-(2-ethoxyethoxy)ethyl]indeno[1,2-b]fluorene.
| Compound Name | 2,8-dibromo-6,6,12,12-tetrakis[2-(2-ethoxyethoxy)ethyl]indeno[1,2-b]fluorene |
|---|---|
| PubChem CID | 67476758 |
| Molecular Formula | C44H60Br2O8 |
| Molecular Weight | 876.76 g/mol |
| Exact Mass | 874.27 |
| IUPAC Name | 2,8-dibromo-6,6,12,12-tetrakis[2-(2-ethoxyethoxy)ethyl]indeno[1,2-b]fluorene |
| SMILES | CCOCCOCCC1(CCOCCOCC)c2cc(Br)ccc2-c2cc3c(cc21)-c1ccc(Br)cc1C3(CCOCCOCC)CCOCCOCC |
| InChI | InChI=1S/C44H60Br2O8/c1-5-47-21-25-51-17-13-43(14-18-52-26-22-48-6-2)39-29-33(45)9-11-35(39)37-32-42-38(31-41(37)43)36-12-10-34(46)30-40(36)44(42,15-19-53-27-23-49-7-3)16-20-54-28-24-50-8-4/h9-12,29-32H,5-8,13-28H2,1-4H3 |
| InChIKey | UWCFARNHSHYNJH-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.76 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|