C28H27FO8 — CID 67477252
methyl (1R,2R,3S,3aR,8bS)-3-(3-fluorophenyl)-1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate (PubChem CID 67477252) has the molecular formula C28H27FO8 and a molecular weight of 510.51 g/mol. Its IUPAC name is methyl (1R,2R,3S,3aR,8bS)-3-(3-fluorophenyl)-1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate.
| Compound Name | methyl (1R,2R,3S,3aR,8bS)-3-(3-fluorophenyl)-1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 67477252 |
| Molecular Formula | C28H27FO8 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | methyl (1R,2R,3S,3aR,8bS)-3-(3-fluorophenyl)-1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](O)[C@@]2(O)c3c(OC)cc(OC)cc3O[C@@]2(c2ccc(OC)cc2)[C@@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C28H27FO8/c1-33-18-10-8-16(9-11-18)28-23(15-6-5-7-17(29)12-15)22(26(31)36-4)25(30)27(28,32)24-20(35-3)13-19(34-2)14-21(24)37-28/h5-14,22-23,25,30,32H,1-4H3/t22-,23-,25-,27+,28+/m1/s1 |
| InChIKey | NVJSPTAXTUVSDN-GWNOIRNCSA-N |
| XLogP | 3.27 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |