About N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide
N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide (PubChem CID 67477256) has the molecular formula C8H14F3NO2S
and a molecular weight of 245.27 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide.
Molecular Properties
| Compound Name | N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide |
| PubChem CID | 67477256 |
| Molecular Formula | C8H14F3NO2S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NCC1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C8H14F3NO2S/c9-8(10,11)15(13,14)12-6-7-4-2-1-3-5-7/h7,12H,1-6H2 |
| InChIKey | XEHFZDDRWWVIFN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide?
The IUPAC name of N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide (CID 67477256) is N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide.
What is the SMILES notation for N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide?
The canonical SMILES for N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide is O=S(=O)(NCC1CCCCC1)C(F)(F)F.
What is the InChIKey of N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide?
The InChIKey is XEHFZDDRWWVIFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14F3NO2S/c9-8(10,11)15(13,14)12-6-7-4-2-1-3-5-7/h7,12H,1-6H2.
What are the key properties of N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide?
N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide has a molecular weight of 245.27 g/mol, XLogP of 2.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexylmethyl)-1,1,1-trifluoromethanesulfonamide is sourced from PubChem (CID 67477256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).