About 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine
3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine (PubChem CID 67477447) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine |
| PubChem CID | 67477447 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine |
| SMILES | C=CC1=C(/C=C\C)C=CNC1 |
| InChI | InChI=1S/C10H13N/c1-3-5-10-6-7-11-8-9(10)4-2/h3-7,11H,2,8H2,1H3/b5-3- |
| InChIKey | VLHREQOZQVVVPR-HYXAFXHYSA-N |
| XLogP | 2.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine?
The IUPAC name of 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine (CID 67477447) is 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine.
What is the SMILES notation for 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine?
The canonical SMILES for 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine is C=CC1=C(/C=C\C)C=CNC1.
What is the InChIKey of 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine?
The InChIKey is VLHREQOZQVVVPR-HYXAFXHYSA-N. The full InChI is InChI=1S/C10H13N/c1-3-5-10-6-7-11-8-9(10)4-2/h3-7,11H,2,8H2,1H3/b5-3-.
What are the key properties of 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine?
3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine has a molecular weight of 147.22 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-4-[(Z)-prop-1-enyl]-1,2-dihydropyridine is sourced from PubChem (CID 67477447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).