C20H19FN2O2S — CID 67477644
N-[(4aS,7aS)-7a-(2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide (PubChem CID 67477644) has the molecular formula C20H19FN2O2S and a molecular weight of 370.45 g/mol. Its IUPAC name is N-[(4aS,7aS)-7a-(2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide.
| Compound Name | N-[(4aS,7aS)-7a-(2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide |
|---|---|
| PubChem CID | 67477644 |
| Molecular Formula | C20H19FN2O2S |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N-[(4aS,7aS)-7a-(2-fluorophenyl)-5-methyl-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]thiazin-2-yl]benzamide |
| SMILES | CC1OC[C@]2(c3ccccc3F)N=C(NC(=O)c3ccccc3)SC[C@H]12 |
| InChI | InChI=1S/C20H19FN2O2S/c1-13-16-11-26-19(22-18(24)14-7-3-2-4-8-14)23-20(16,12-25-13)15-9-5-6-10-17(15)21/h2-10,13,16H,11-12H2,1H3,(H,22,23,24)/t13?,16-,20-/m1/s1 |
| InChIKey | MRRXXRHHUDDQLJ-ZWARMNSPSA-N |
| XLogP | 3.59 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |