C8H13NO2 — CID 67477668
(6S)-6-methoxy-3,3a,4,5,6,7-hexahydro-2,1-benzoxazole (PubChem CID 67477668) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (6S)-6-methoxy-3,3a,4,5,6,7-hexahydro-2,1-benzoxazole.
| Compound Name | (6S)-6-methoxy-3,3a,4,5,6,7-hexahydro-2,1-benzoxazole |
|---|---|
| PubChem CID | 67477668 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (6S)-6-methoxy-3,3a,4,5,6,7-hexahydro-2,1-benzoxazole |
| SMILES | CO[C@H]1CCC2CON=C2C1 |
| InChI | InChI=1S/C8H13NO2/c1-10-7-3-2-6-5-11-9-8(6)4-7/h6-7H,2-5H2,1H3/t6?,7-/m0/s1 |
| InChIKey | IXSOZVVCMRNQLO-MLWJPKLSSA-N |
| XLogP | 1.19 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |