C17H26FNO3 — CID 67478085
[(3R,4S,6R)-4-amino-6-(butoxymethyl)-4-(2-fluorophenyl)oxan-3-yl]methanol (PubChem CID 67478085) has the molecular formula C17H26FNO3 and a molecular weight of 311.40 g/mol. Its IUPAC name is [(3R,4S,6R)-4-amino-6-(butoxymethyl)-4-(2-fluorophenyl)oxan-3-yl]methanol.
| Compound Name | [(3R,4S,6R)-4-amino-6-(butoxymethyl)-4-(2-fluorophenyl)oxan-3-yl]methanol |
|---|---|
| PubChem CID | 67478085 |
| Molecular Formula | C17H26FNO3 |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | [(3R,4S,6R)-4-amino-6-(butoxymethyl)-4-(2-fluorophenyl)oxan-3-yl]methanol |
| SMILES | CCCCOC[C@H]1C[C@@](N)(c2ccccc2F)[C@H](CO)CO1 |
| InChI | InChI=1S/C17H26FNO3/c1-2-3-8-21-12-14-9-17(19,13(10-20)11-22-14)15-6-4-5-7-16(15)18/h4-7,13-14,20H,2-3,8-12,19H2,1H3/t13-,14-,17+/m1/s1 |
| InChIKey | NLYZUDSHWIVGPT-CPUCHLNUSA-N |
| XLogP | 2.19 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|