About 3-chlorocyclohex-3-ene-1,2-diol
3-chlorocyclohex-3-ene-1,2-diol (PubChem CID 67478203) has the molecular formula C6H9ClO2
and a molecular weight of 148.59 g/mol. Its IUPAC name is 3-chlorocyclohex-3-ene-1,2-diol.
Molecular Properties
| Compound Name | 3-chlorocyclohex-3-ene-1,2-diol |
| PubChem CID | 67478203 |
| Molecular Formula | C6H9ClO2 |
| Molecular Weight | 148.59 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | 3-chlorocyclohex-3-ene-1,2-diol |
| SMILES | OC1CCC=C(Cl)C1O |
| InChI | InChI=1S/C6H9ClO2/c7-4-2-1-3-5(8)6(4)9/h2,5-6,8-9H,1,3H2 |
| InChIKey | POQMPIZDNRDMKF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.59 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-chlorocyclohex-3-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorocyclohex-3-ene-1,2-diol?
The IUPAC name of 3-chlorocyclohex-3-ene-1,2-diol (CID 67478203) is 3-chlorocyclohex-3-ene-1,2-diol.
What is the SMILES notation for 3-chlorocyclohex-3-ene-1,2-diol?
The canonical SMILES for 3-chlorocyclohex-3-ene-1,2-diol is OC1CCC=C(Cl)C1O.
What is the InChIKey of 3-chlorocyclohex-3-ene-1,2-diol?
The InChIKey is POQMPIZDNRDMKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO2/c7-4-2-1-3-5(8)6(4)9/h2,5-6,8-9H,1,3H2.
What are the key properties of 3-chlorocyclohex-3-ene-1,2-diol?
3-chlorocyclohex-3-ene-1,2-diol has a molecular weight of 148.59 g/mol, XLogP of 0.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorocyclohex-3-ene-1,2-diol is sourced from PubChem (CID 67478203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).