C8H14Cl2N2 — CID 67478393
2,3-dichloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline (PubChem CID 67478393) has the molecular formula C8H14Cl2N2 and a molecular weight of 209.12 g/mol. Its IUPAC name is 2,3-dichloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline.
| Compound Name | 2,3-dichloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline |
|---|---|
| PubChem CID | 67478393 |
| Molecular Formula | C8H14Cl2N2 |
| Molecular Weight | 209.12 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2,3-dichloro-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxaline |
| SMILES | ClC1NC2CCCCC2NC1Cl |
| InChI | InChI=1S/C8H14Cl2N2/c9-7-8(10)12-6-4-2-1-3-5(6)11-7/h5-8,11-12H,1-4H2 |
| InChIKey | ONBCIUGVPVHWIM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.12 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|