C27H20N4O5 — CID 67478561
4-[(2S)-4-benzoyl-8,9-dioxo-4,7,14,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11(16),12,14-tetraen-15-yl]benzoic acid (PubChem CID 67478561) has the molecular formula C27H20N4O5 and a molecular weight of 480.48 g/mol. Its IUPAC name is 4-[(2S)-4-benzoyl-8,9-dioxo-4,7,14,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11(16),12,14-tetraen-15-yl]benzoic acid.
| Compound Name | 4-[(2S)-4-benzoyl-8,9-dioxo-4,7,14,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11(16),12,14-tetraen-15-yl]benzoic acid |
|---|---|
| PubChem CID | 67478561 |
| Molecular Formula | C27H20N4O5 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 4-[(2S)-4-benzoyl-8,9-dioxo-4,7,14,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11(16),12,14-tetraen-15-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nccc3c4c([nH]c23)[C@@H]2CN(C(=O)c3ccccc3)CCN2C(=O)C4=O)cc1 |
| InChI | InChI=1S/C27H20N4O5/c32-24-20-18-10-11-28-21(15-6-8-17(9-7-15)27(35)36)22(18)29-23(20)19-14-30(12-13-31(19)26(24)34)25(33)16-4-2-1-3-5-16/h1-11,19,29H,12-14H2,(H,35,36)/t19-/m0/s1 |
| InChIKey | YFEZJYLLUVUDLE-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 123.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|