About 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane
9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane (PubChem CID 67478599) has the molecular formula C15H26F2N2
and a molecular weight of 272.38 g/mol. Its IUPAC name is 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane |
| PubChem CID | 67478599 |
| Molecular Formula | C15H26F2N2 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane |
| SMILES | CCN1CCC2(CCC(N3CC(F)(F)C3)CC2)CC1 |
| InChI | InChI=1S/C15H26F2N2/c1-2-18-9-7-14(8-10-18)5-3-13(4-6-14)19-11-15(16,17)12-19/h13H,2-12H2,1H3 |
| InChIKey | WGQSSVICDCWULR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane?
The IUPAC name of 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane (CID 67478599) is 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane.
What is the SMILES notation for 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane?
The canonical SMILES for 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane is CCN1CCC2(CCC(N3CC(F)(F)C3)CC2)CC1.
What is the InChIKey of 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane?
The InChIKey is WGQSSVICDCWULR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26F2N2/c1-2-18-9-7-14(8-10-18)5-3-13(4-6-14)19-11-15(16,17)12-19/h13H,2-12H2,1H3.
What are the key properties of 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane?
9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane has a molecular weight of 272.38 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3,3-difluoroazetidin-1-yl)-3-ethyl-3-azaspiro[5.5]undecane is sourced from PubChem (CID 67478599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).