C20H36N2O3Si — CID 67479240
N'-(3-phenylprop-2-enyl)-N'-(3-triethoxysilylpropyl)ethane-1,2-diamine (PubChem CID 67479240) has the molecular formula C20H36N2O3Si and a molecular weight of 380.61 g/mol. Its IUPAC name is N'-(3-phenylprop-2-enyl)-N'-(3-triethoxysilylpropyl)ethane-1,2-diamine.
| Compound Name | N'-(3-phenylprop-2-enyl)-N'-(3-triethoxysilylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 67479240 |
| Molecular Formula | C20H36N2O3Si |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | N'-(3-phenylprop-2-enyl)-N'-(3-triethoxysilylpropyl)ethane-1,2-diamine |
| SMILES | CCO[Si](CCCN(CC=Cc1ccccc1)CCN)(OCC)OCC |
| InChI | InChI=1S/C20H36N2O3Si/c1-4-23-26(24-5-2,25-6-3)19-11-17-22(18-15-21)16-10-14-20-12-8-7-9-13-20/h7-10,12-14H,4-6,11,15-19,21H2,1-3H3 |
| InChIKey | CVLWSQYXHSLGJA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|