About 2-chloro-4,4-dimethyl-1H-pyrimidine
2-chloro-4,4-dimethyl-1H-pyrimidine (PubChem CID 67479805) has the molecular formula C6H9ClN2
and a molecular weight of 144.60 g/mol. Its IUPAC name is 2-chloro-4,4-dimethyl-1H-pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-4,4-dimethyl-1H-pyrimidine |
| PubChem CID | 67479805 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 2-chloro-4,4-dimethyl-1H-pyrimidine |
| SMILES | CC1(C)C=CNC(Cl)=N1 |
| InChI | InChI=1S/C6H9ClN2/c1-6(2)3-4-8-5(7)9-6/h3-4H,1-2H3,(H,8,9) |
| InChIKey | ABHOQHQJPBFTGN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4,4-dimethyl-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,4-dimethyl-1H-pyrimidine?
The IUPAC name of 2-chloro-4,4-dimethyl-1H-pyrimidine (CID 67479805) is 2-chloro-4,4-dimethyl-1H-pyrimidine.
What is the SMILES notation for 2-chloro-4,4-dimethyl-1H-pyrimidine?
The canonical SMILES for 2-chloro-4,4-dimethyl-1H-pyrimidine is CC1(C)C=CNC(Cl)=N1.
What is the InChIKey of 2-chloro-4,4-dimethyl-1H-pyrimidine?
The InChIKey is ABHOQHQJPBFTGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2/c1-6(2)3-4-8-5(7)9-6/h3-4H,1-2H3,(H,8,9).
What are the key properties of 2-chloro-4,4-dimethyl-1H-pyrimidine?
2-chloro-4,4-dimethyl-1H-pyrimidine has a molecular weight of 144.60 g/mol, XLogP of 1.48, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,4-dimethyl-1H-pyrimidine is sourced from PubChem (CID 67479805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).