C34H35N7O8 — CID 67480487
3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;benzyl N-[2-(1,5-diamino-1,5-dioxopentan-3-yl)-1-oxo-3H-isoindol-4-yl]carbamate (PubChem CID 67480487) has the molecular formula C34H35N7O8 and a molecular weight of 669.70 g/mol. Its IUPAC name is 3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;benzyl N-[2-(1,5-diamino-1,5-dioxopentan-3-yl)-1-oxo-3H-isoindol-4-yl]carbamate.
| Compound Name | 3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;benzyl N-[2-(1,5-diamino-1,5-dioxopentan-3-yl)-1-oxo-3H-isoindol-4-yl]carbamate |
|---|---|
| PubChem CID | 67480487 |
| Molecular Formula | C34H35N7O8 |
| Molecular Weight | 669.70 g/mol |
| Exact Mass | 669.25 |
| IUPAC Name | 3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;benzyl N-[2-(1,5-diamino-1,5-dioxopentan-3-yl)-1-oxo-3H-isoindol-4-yl]carbamate |
| SMILES | NC(=O)CC(CC(N)=O)N1Cc2c(NC(=O)OCc3ccccc3)cccc2C1=O.Nc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C21H22N4O5.C13H13N3O3/c22-18(26)9-14(10-19(23)27)25-11-16-15(20(25)28)7-4-8-17(16)24-21(29)30-12-13-5-2-1-3-6-13;14-9-3-1-2-7-8(9)6-16(13(7)19)10-4-5-11(17)15-12(10)18/h1-8,14H,9-12H2,(H2,22,26)(H2,23,27)(H,24,29);1-3,10H,4-6,14H2,(H,15,17,18) |
| InChIKey | JMTSOSGUTHGDCN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 237.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.70 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|