C25H28N6O4S2 — CID 67481430
N-[4-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]phenyl]-N-methylmethanesulfonamide (PubChem CID 67481430) has the molecular formula C25H28N6O4S2 and a molecular weight of 540.67 g/mol. Its IUPAC name is N-[4-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]phenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[4-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]phenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 67481430 |
| Molecular Formula | C25H28N6O4S2 |
| Molecular Weight | 540.67 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | N-[4-[2-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]anilino]-[1,2,4]triazolo[1,5-a]pyridin-8-yl]phenyl]-N-methylmethanesulfonamide |
| SMILES | CN(c1ccc(-c2cccn3nc(Nc4ccc(CN5CCS(=O)(=O)CC5)cc4)nc23)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C25H28N6O4S2/c1-29(36(2,32)33)22-11-7-20(8-12-22)23-4-3-13-31-24(23)27-25(28-31)26-21-9-5-19(6-10-21)18-30-14-16-37(34,35)17-15-30/h3-13H,14-18H2,1-2H3,(H,26,28) |
| InChIKey | FOMSLMYHRMDFKJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |