C11H20O4 — CID 67481894
(2R,3R,4R)-2-(hydroxymethyl)-6-pentyl-3,4-dihydro-2H-pyran-3,4-diol (PubChem CID 67481894) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is (2R,3R,4R)-2-(hydroxymethyl)-6-pentyl-3,4-dihydro-2H-pyran-3,4-diol.
| Compound Name | (2R,3R,4R)-2-(hydroxymethyl)-6-pentyl-3,4-dihydro-2H-pyran-3,4-diol |
|---|---|
| PubChem CID | 67481894 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (2R,3R,4R)-2-(hydroxymethyl)-6-pentyl-3,4-dihydro-2H-pyran-3,4-diol |
| SMILES | CCCCCC1=C[C@@H](O)[C@@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C11H20O4/c1-2-3-4-5-8-6-9(13)11(14)10(7-12)15-8/h6,9-14H,2-5,7H2,1H3/t9-,10-,11-/m1/s1 |
| InChIKey | LYJHKOQIZMYVHX-GMTAPVOTSA-N |
| XLogP | 0.56 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|