About N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide
N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide (PubChem CID 67482217) has the molecular formula C5H6N2OS2
and a molecular weight of 174.25 g/mol. Its IUPAC name is N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide.
Molecular Properties
| Compound Name | N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide |
| PubChem CID | 67482217 |
| Molecular Formula | C5H6N2OS2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 173.99 |
| IUPAC Name | N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide |
| SMILES | CC(=O)Nc1csc(=S)[nH]1 |
| InChI | InChI=1S/C5H6N2OS2/c1-3(8)6-4-2-10-5(9)7-4/h2H,1H3,(H,6,8)(H,7,9) |
| InChIKey | OCNVHWIATFZNEU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide?
The IUPAC name of N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide (CID 67482217) is N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide.
What is the SMILES notation for N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide?
The canonical SMILES for N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide is CC(=O)Nc1csc(=S)[nH]1.
What is the InChIKey of N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide?
The InChIKey is OCNVHWIATFZNEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2OS2/c1-3(8)6-4-2-10-5(9)7-4/h2H,1H3,(H,6,8)(H,7,9).
What are the key properties of N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide?
N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide has a molecular weight of 174.25 g/mol, XLogP of 1.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-sulfanylidene-3H-1,3-thiazol-4-yl)acetamide is sourced from PubChem (CID 67482217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).