About N-ethyl-2-methyl-1,3-thiazol-4-amine
N-ethyl-2-methyl-1,3-thiazol-4-amine (PubChem CID 67482238) has the molecular formula C6H10N2S
and a molecular weight of 142.23 g/mol. Its IUPAC name is N-ethyl-2-methyl-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | N-ethyl-2-methyl-1,3-thiazol-4-amine |
| PubChem CID | 67482238 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | N-ethyl-2-methyl-1,3-thiazol-4-amine |
| SMILES | CCNc1csc(C)n1 |
| InChI | InChI=1S/C6H10N2S/c1-3-7-6-4-9-5(2)8-6/h4,7H,3H2,1-2H3 |
| InChIKey | SUIQOOXCMJERDW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-2-methyl-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-methyl-1,3-thiazol-4-amine?
The IUPAC name of N-ethyl-2-methyl-1,3-thiazol-4-amine (CID 67482238) is N-ethyl-2-methyl-1,3-thiazol-4-amine.
What is the SMILES notation for N-ethyl-2-methyl-1,3-thiazol-4-amine?
The canonical SMILES for N-ethyl-2-methyl-1,3-thiazol-4-amine is CCNc1csc(C)n1.
What is the InChIKey of N-ethyl-2-methyl-1,3-thiazol-4-amine?
The InChIKey is SUIQOOXCMJERDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S/c1-3-7-6-4-9-5(2)8-6/h4,7H,3H2,1-2H3.
What are the key properties of N-ethyl-2-methyl-1,3-thiazol-4-amine?
N-ethyl-2-methyl-1,3-thiazol-4-amine has a molecular weight of 142.23 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-methyl-1,3-thiazol-4-amine is sourced from PubChem (CID 67482238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).