About 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione
4-(2-aminoethyl)-3H-1,3-thiazole-2-thione (PubChem CID 67482243) has the molecular formula C5H8N2S2
and a molecular weight of 160.27 g/mol. Its IUPAC name is 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione |
| PubChem CID | 67482243 |
| Molecular Formula | C5H8N2S2 |
| Molecular Weight | 160.27 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione |
| SMILES | NCCc1csc(=S)[nH]1 |
| InChI | InChI=1S/C5H8N2S2/c6-2-1-4-3-9-5(8)7-4/h3H,1-2,6H2,(H,7,8) |
| InChIKey | ZMZWBCSATZZJEU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.27 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione?
The IUPAC name of 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione (CID 67482243) is 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione.
What is the SMILES notation for 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione?
The canonical SMILES for 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione is NCCc1csc(=S)[nH]1.
What is the InChIKey of 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione?
The InChIKey is ZMZWBCSATZZJEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2S2/c6-2-1-4-3-9-5(8)7-4/h3H,1-2,6H2,(H,7,8).
What are the key properties of 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione?
4-(2-aminoethyl)-3H-1,3-thiazole-2-thione has a molecular weight of 160.27 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-3H-1,3-thiazole-2-thione is sourced from PubChem (CID 67482243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).