About N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide
N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide (PubChem CID 67482344) has the molecular formula C6H8N2OS2
and a molecular weight of 188.28 g/mol. Its IUPAC name is N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide |
| PubChem CID | 67482344 |
| Molecular Formula | C6H8N2OS2 |
| Molecular Weight | 188.28 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide |
| SMILES | CCNC(=O)c1csc(=S)[nH]1 |
| InChI | InChI=1S/C6H8N2OS2/c1-2-7-5(9)4-3-11-6(10)8-4/h3H,2H2,1H3,(H,7,9)(H,8,10) |
| InChIKey | GNGDFSDNLFZSMA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide?
The IUPAC name of N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide (CID 67482344) is N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide is CCNC(=O)c1csc(=S)[nH]1.
What is the InChIKey of N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide?
The InChIKey is GNGDFSDNLFZSMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS2/c1-2-7-5(9)4-3-11-6(10)8-4/h3H,2H2,1H3,(H,7,9)(H,8,10).
What are the key properties of N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide?
N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide has a molecular weight of 188.28 g/mol, XLogP of 1.56, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-sulfanylidene-3H-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 67482344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).