C17H24N4O3S — CID 67483366
4-[4-cyano-5-(2-ethylbutanoylamino)-3-methylthiophen-2-yl]piperazine-1-carboxylic acid (PubChem CID 67483366) has the molecular formula C17H24N4O3S and a molecular weight of 364.47 g/mol. Its IUPAC name is 4-[4-cyano-5-(2-ethylbutanoylamino)-3-methylthiophen-2-yl]piperazine-1-carboxylic acid.
| Compound Name | 4-[4-cyano-5-(2-ethylbutanoylamino)-3-methylthiophen-2-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 67483366 |
| Molecular Formula | C17H24N4O3S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-[4-cyano-5-(2-ethylbutanoylamino)-3-methylthiophen-2-yl]piperazine-1-carboxylic acid |
| SMILES | CCC(CC)C(=O)Nc1sc(N2CCN(C(=O)O)CC2)c(C)c1C#N |
| InChI | InChI=1S/C17H24N4O3S/c1-4-12(5-2)14(22)19-15-13(10-18)11(3)16(25-15)20-6-8-21(9-7-20)17(23)24/h12H,4-9H2,1-3H3,(H,19,22)(H,23,24) |
| InChIKey | WLGVCYBQGVHZFY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |