About diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate
diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate (PubChem CID 67483484) has the molecular formula C11H13NO5
and a molecular weight of 239.23 g/mol. Its IUPAC name is diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate |
| PubChem CID | 67483484 |
| Molecular Formula | C11H13NO5 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=CN=CC(C(=O)OCC)C1=O |
| InChI | InChI=1S/C11H13NO5/c1-3-16-10(14)7-5-12-6-8(9(7)13)11(15)17-4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | QWLHYRGPFRSQBO-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate?
The IUPAC name of diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate (CID 67483484) is diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate.
What is the SMILES notation for diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate?
The canonical SMILES for diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate is CCOC(=O)C1=CN=CC(C(=O)OCC)C1=O.
What is the InChIKey of diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate?
The InChIKey is QWLHYRGPFRSQBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO5/c1-3-16-10(14)7-5-12-6-8(9(7)13)11(15)17-4-2/h5-7H,3-4H2,1-2H3.
What are the key properties of diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate?
diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate has a molecular weight of 239.23 g/mol, XLogP of 0.27, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-oxo-3H-pyridine-3,5-dicarboxylate is sourced from PubChem (CID 67483484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).