About N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine
N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine (PubChem CID 67483668) has the molecular formula C15H26F3NO
and a molecular weight of 293.37 g/mol. Its IUPAC name is N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine |
| PubChem CID | 67483668 |
| Molecular Formula | C15H26F3NO |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine |
| SMILES | FC(F)(F)COCC1CCC(NC2CCCCC2)CC1 |
| InChI | InChI=1S/C15H26F3NO/c16-15(17,18)11-20-10-12-6-8-14(9-7-12)19-13-4-2-1-3-5-13/h12-14,19H,1-11H2 |
| InChIKey | YCBVHARHNVZEHH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine?
The IUPAC name of N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine (CID 67483668) is N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine.
What is the SMILES notation for N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine?
The canonical SMILES for N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine is FC(F)(F)COCC1CCC(NC2CCCCC2)CC1.
What is the InChIKey of N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine?
The InChIKey is YCBVHARHNVZEHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26F3NO/c16-15(17,18)11-20-10-12-6-8-14(9-7-12)19-13-4-2-1-3-5-13/h12-14,19H,1-11H2.
What are the key properties of N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine?
N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine has a molecular weight of 293.37 g/mol, XLogP of 4.05, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexan-1-amine is sourced from PubChem (CID 67483668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).