About 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate
1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate (PubChem CID 67484160) has the molecular formula C24H19N3O3
and a molecular weight of 397.43 g/mol. Its IUPAC name is 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate.
Molecular Properties
| Compound Name | 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate |
| PubChem CID | 67484160 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate |
| SMILES | CC(OC(=O)c1cccc(-n2cnc3cc(-c4ccoc4)ccc32)c1)c1ccc[nH]1 |
| InChI | InChI=1S/C24H19N3O3/c1-16(21-6-3-10-25-21)30-24(28)18-4-2-5-20(12-18)27-15-26-22-13-17(7-8-23(22)27)19-9-11-29-14-19/h2-16,25H,1H3 |
| InChIKey | YJDPTCRHSNHIKZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate?
The IUPAC name of 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate (CID 67484160) is 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate.
What is the SMILES notation for 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate?
The canonical SMILES for 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate is CC(OC(=O)c1cccc(-n2cnc3cc(-c4ccoc4)ccc32)c1)c1ccc[nH]1.
What is the InChIKey of 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate?
The InChIKey is YJDPTCRHSNHIKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19N3O3/c1-16(21-6-3-10-25-21)30-24(28)18-4-2-5-20(12-18)27-15-26-22-13-17(7-8-23(22)27)19-9-11-29-14-19/h2-16,25H,1H3.
What are the key properties of 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate?
1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate has a molecular weight of 397.43 g/mol, XLogP of 5.53, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-pyrrol-2-yl)ethyl 3-[5-(furan-3-yl)benzimidazol-1-yl]benzoate is sourced from PubChem (CID 67484160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).