C14H18O4S2 — CID 67484599
2-cyclopentyl-1-(5-methylsulfonylthiophen-3-yl)cyclopropane-1-carboxylic acid (PubChem CID 67484599) has the molecular formula C14H18O4S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-cyclopentyl-1-(5-methylsulfonylthiophen-3-yl)cyclopropane-1-carboxylic acid.
| Compound Name | 2-cyclopentyl-1-(5-methylsulfonylthiophen-3-yl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 67484599 |
| Molecular Formula | C14H18O4S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-cyclopentyl-1-(5-methylsulfonylthiophen-3-yl)cyclopropane-1-carboxylic acid |
| SMILES | CS(=O)(=O)c1cc(C2(C(=O)O)CC2C2CCCC2)cs1 |
| InChI | InChI=1S/C14H18O4S2/c1-20(17,18)12-6-10(8-19-12)14(13(15)16)7-11(14)9-4-2-3-5-9/h6,8-9,11H,2-5,7H2,1H3,(H,15,16) |
| InChIKey | JRPYEDVPYXNDER-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |