About 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid
5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid (PubChem CID 67485492) has the molecular formula C25H25F3O2S2
and a molecular weight of 478.60 g/mol. Its IUPAC name is 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid |
| PubChem CID | 67485492 |
| Molecular Formula | C25H25F3O2S2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid |
| SMILES | CCCCC(Sc1cc(C)c(-c2ccc(C(F)(F)F)cc2)c(C)c1)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C25H25F3O2S2/c1-4-5-6-20(21-11-12-22(32-21)24(29)30)31-19-13-15(2)23(16(3)14-19)17-7-9-18(10-8-17)25(26,27)28/h7-14,20H,4-6H2,1-3H3,(H,29,30) |
| InChIKey | DIOSCFXEHMATBI-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid (CID 67485492) is 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid is CCCCC(Sc1cc(C)c(-c2ccc(C(F)(F)F)cc2)c(C)c1)c1ccc(C(=O)O)s1.
What is the InChIKey of 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid?
The InChIKey is DIOSCFXEHMATBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25F3O2S2/c1-4-5-6-20(21-11-12-22(32-21)24(29)30)31-19-13-15(2)23(16(3)14-19)17-7-9-18(10-8-17)25(26,27)28/h7-14,20H,4-6H2,1-3H3,(H,29,30).
What are the key properties of 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid?
5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid has a molecular weight of 478.60 g/mol, XLogP of 8.77, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]phenyl]sulfanylpentyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 67485492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).