C11H8Br2N2O — CID 67485564
3-(2,4-dibromophenoxy)pyridin-2-amine (PubChem CID 67485564) has the molecular formula C11H8Br2N2O and a molecular weight of 344.01 g/mol. Its IUPAC name is 3-(2,4-dibromophenoxy)pyridin-2-amine.
| Compound Name | 3-(2,4-dibromophenoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 67485564 |
| Molecular Formula | C11H8Br2N2O |
| Molecular Weight | 344.01 g/mol |
| Exact Mass | 341.90 |
| IUPAC Name | 3-(2,4-dibromophenoxy)pyridin-2-amine |
| SMILES | Nc1ncccc1Oc1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H8Br2N2O/c12-7-3-4-9(8(13)6-7)16-10-2-1-5-15-11(10)14/h1-6H,(H2,14,15) |
| InChIKey | UUAQGBUABJHYAO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.01 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |