C17H19N9O2 — CID 67485672
5-methyl-3-[6-[(1-methyl-1,2,4-triazol-3-yl)methoxy]-7-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]-1,2-oxazole (PubChem CID 67485672) has the molecular formula C17H19N9O2 and a molecular weight of 381.40 g/mol. Its IUPAC name is 5-methyl-3-[6-[(1-methyl-1,2,4-triazol-3-yl)methoxy]-7-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]-1,2-oxazole.
| Compound Name | 5-methyl-3-[6-[(1-methyl-1,2,4-triazol-3-yl)methoxy]-7-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 67485672 |
| Molecular Formula | C17H19N9O2 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 5-methyl-3-[6-[(1-methyl-1,2,4-triazol-3-yl)methoxy]-7-pyrrolidin-1-yl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]-1,2-oxazole |
| SMILES | Cc1cc(-c2nnc3cc(N4CCCC4)c(OCc4ncn(C)n4)nn23)no1 |
| InChI | InChI=1S/C17H19N9O2/c1-11-7-12(23-28-11)16-20-19-15-8-13(25-5-3-4-6-25)17(22-26(15)16)27-9-14-18-10-24(2)21-14/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | UWXFOWSVWFVVFR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 112.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |