About 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene
1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene (PubChem CID 67485715) has the molecular formula C27H24BrF3O
and a molecular weight of 501.39 g/mol. Its IUPAC name is 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene.
Molecular Properties
| Compound Name | 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene |
| PubChem CID | 67485715 |
| Molecular Formula | C27H24BrF3O |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene |
| SMILES | C=CCC(CC=C)(COc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H24BrF3O/c1-3-17-26(18-4-2,22-11-13-24(28)14-12-22)19-32-25-15-7-21(8-16-25)20-5-9-23(10-6-20)27(29,30)31/h3-16H,1-2,17-19H2 |
| InChIKey | IRDQULFWQKZWTA-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene?
The IUPAC name of 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene (CID 67485715) is 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene.
What is the SMILES notation for 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene?
The canonical SMILES for 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene is C=CCC(CC=C)(COc1ccc(-c2ccc(C(F)(F)F)cc2)cc1)c1ccc(Br)cc1.
What is the InChIKey of 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene?
The InChIKey is IRDQULFWQKZWTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24BrF3O/c1-3-17-26(18-4-2,22-11-13-24(28)14-12-22)19-32-25-15-7-21(8-16-25)20-5-9-23(10-6-20)27(29,30)31/h3-16H,1-2,17-19H2.
What are the key properties of 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene?
1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene has a molecular weight of 501.39 g/mol, XLogP of 8.60, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-[4-[[4-[4-(trifluoromethyl)phenyl]phenoxy]methyl]hepta-1,6-dien-4-yl]benzene is sourced from PubChem (CID 67485715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).