C22H18F3N3 — CID 67485730
1-phenyl-7-[3-(1,2,3,6-tetrahydropyridin-2-yl)prop-1-ynyl]-5-(trifluoromethyl)benzimidazole (PubChem CID 67485730) has the molecular formula C22H18F3N3 and a molecular weight of 381.40 g/mol. Its IUPAC name is 1-phenyl-7-[3-(1,2,3,6-tetrahydropyridin-2-yl)prop-1-ynyl]-5-(trifluoromethyl)benzimidazole.
| Compound Name | 1-phenyl-7-[3-(1,2,3,6-tetrahydropyridin-2-yl)prop-1-ynyl]-5-(trifluoromethyl)benzimidazole |
|---|---|
| PubChem CID | 67485730 |
| Molecular Formula | C22H18F3N3 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-phenyl-7-[3-(1,2,3,6-tetrahydropyridin-2-yl)prop-1-ynyl]-5-(trifluoromethyl)benzimidazole |
| SMILES | FC(F)(F)c1cc(C#CCC2CC=CCN2)c2c(c1)ncn2-c1ccccc1 |
| InChI | InChI=1S/C22H18F3N3/c23-22(24,25)17-13-16(7-6-9-18-8-4-5-12-26-18)21-20(14-17)27-15-28(21)19-10-2-1-3-11-19/h1-5,10-11,13-15,18,26H,8-9,12H2 |
| InChIKey | ALOIVBBBQZLWHH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|