About 8-fluoroimidazo[1,2-c]pyrimidine
8-fluoroimidazo[1,2-c]pyrimidine (PubChem CID 67486651) has the molecular formula C6H4FN3
and a molecular weight of 137.12 g/mol. Its IUPAC name is 8-fluoroimidazo[1,2-c]pyrimidine.
Molecular Properties
| Compound Name | 8-fluoroimidazo[1,2-c]pyrimidine |
| PubChem CID | 67486651 |
| Molecular Formula | C6H4FN3 |
| Molecular Weight | 137.12 g/mol |
| Exact Mass | 137.04 |
| IUPAC Name | 8-fluoroimidazo[1,2-c]pyrimidine |
| SMILES | Fc1cncn2ccnc12 |
| InChI | InChI=1S/C6H4FN3/c7-5-3-8-4-10-2-1-9-6(5)10/h1-4H |
| InChIKey | GMGPAXNXSDJGSL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.12 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoroimidazo[1,2-c]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoroimidazo[1,2-c]pyrimidine?
The IUPAC name of 8-fluoroimidazo[1,2-c]pyrimidine (CID 67486651) is 8-fluoroimidazo[1,2-c]pyrimidine.
What is the SMILES notation for 8-fluoroimidazo[1,2-c]pyrimidine?
The canonical SMILES for 8-fluoroimidazo[1,2-c]pyrimidine is Fc1cncn2ccnc12.
What is the InChIKey of 8-fluoroimidazo[1,2-c]pyrimidine?
The InChIKey is GMGPAXNXSDJGSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4FN3/c7-5-3-8-4-10-2-1-9-6(5)10/h1-4H.
What are the key properties of 8-fluoroimidazo[1,2-c]pyrimidine?
8-fluoroimidazo[1,2-c]pyrimidine has a molecular weight of 137.12 g/mol, XLogP of 0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoroimidazo[1,2-c]pyrimidine is sourced from PubChem (CID 67486651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).