C11H13N3O — CID 67487856
1-amino-N,4-dimethylindole-2-carboxamide (PubChem CID 67487856) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-amino-N,4-dimethylindole-2-carboxamide.
| Compound Name | 1-amino-N,4-dimethylindole-2-carboxamide |
|---|---|
| PubChem CID | 67487856 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1-amino-N,4-dimethylindole-2-carboxamide |
| SMILES | CNC(=O)c1cc2c(C)cccc2n1N |
| InChI | InChI=1S/C11H13N3O/c1-7-4-3-5-9-8(7)6-10(14(9)12)11(15)13-2/h3-6H,12H2,1-2H3,(H,13,15) |
| InChIKey | IOQGWVJPBYLXAC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |