About 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide
1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide (PubChem CID 67487864) has the molecular formula C8H10N4O3
and a molecular weight of 210.19 g/mol. Its IUPAC name is 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide |
| PubChem CID | 67487864 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide |
| SMILES | NC(=O)c1ccn(C[C@@H]2CNC(=O)O2)n1 |
| InChI | InChI=1S/C8H10N4O3/c9-7(13)6-1-2-12(11-6)4-5-3-10-8(14)15-5/h1-2,5H,3-4H2,(H2,9,13)(H,10,14)/t5-/m0/s1 |
| InChIKey | KFYKQYDJLCRDDU-YFKPBYRVSA-N |
| XLogP | -0.91 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide?
The IUPAC name of 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide (CID 67487864) is 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide.
What is the SMILES notation for 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide?
The canonical SMILES for 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide is NC(=O)c1ccn(C[C@@H]2CNC(=O)O2)n1.
What is the InChIKey of 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide?
The InChIKey is KFYKQYDJLCRDDU-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H10N4O3/c9-7(13)6-1-2-12(11-6)4-5-3-10-8(14)15-5/h1-2,5H,3-4H2,(H2,9,13)(H,10,14)/t5-/m0/s1.
What are the key properties of 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide?
1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide has a molecular weight of 210.19 g/mol, XLogP of -0.91, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(5S)-2-oxo-1,3-oxazolidin-5-yl]methyl]pyrazole-3-carboxamide is sourced from PubChem (CID 67487864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).