About (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate
(6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate (PubChem CID 67488057) has the molecular formula C16H20N2O3
and a molecular weight of 288.35 g/mol. Its IUPAC name is (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate.
Molecular Properties
| Compound Name | (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate |
| PubChem CID | 67488057 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate |
| SMILES | CC(=O)OCc1cccc(C)n1.Cc1cccc(CO)n1 |
| InChI | InChI=1S/C9H11NO2.C7H9NO/c1-7-4-3-5-9(10-7)6-12-8(2)11;1-6-3-2-4-7(5-9)8-6/h3-5H,6H2,1-2H3;2-4,9H,5H2,1H3 |
| InChIKey | SHJXFWOLVQSHRF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate?
The IUPAC name of (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate (CID 67488057) is (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate.
What is the SMILES notation for (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate?
The canonical SMILES for (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate is CC(=O)OCc1cccc(C)n1.Cc1cccc(CO)n1.
What is the InChIKey of (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate?
The InChIKey is SHJXFWOLVQSHRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.C7H9NO/c1-7-4-3-5-9(10-7)6-12-8(2)11;1-6-3-2-4-7(5-9)8-6/h3-5H,6H2,1-2H3;2-4,9H,5H2,1H3.
What are the key properties of (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate?
(6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate has a molecular weight of 288.35 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-2-pyridinyl)methanol;(6-methyl-2-pyridinyl)methyl acetate is sourced from PubChem (CID 67488057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).