About 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide
4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide (PubChem CID 67488433) has the molecular formula C7H9N3O4
and a molecular weight of 199.17 g/mol. Its IUPAC name is 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide.
Molecular Properties
| Compound Name | 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide |
| PubChem CID | 67488433 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide |
| SMILES | NNC(=O)C1=CCC(O)C([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C7H9N3O4/c8-9-7(12)4-1-2-6(11)5(3-4)10(13)14/h1,3,6,11H,2,8H2,(H,9,12) |
| InChIKey | ZYZFQVMDAFSDQF-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide?
The IUPAC name of 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide (CID 67488433) is 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide.
What is the SMILES notation for 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide?
The canonical SMILES for 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide is NNC(=O)C1=CCC(O)C([N+](=O)[O-])=C1.
What is the InChIKey of 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide?
The InChIKey is ZYZFQVMDAFSDQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O4/c8-9-7(12)4-1-2-6(11)5(3-4)10(13)14/h1,3,6,11H,2,8H2,(H,9,12).
What are the key properties of 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide?
4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide has a molecular weight of 199.17 g/mol, XLogP of -1.17, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-5-nitrocyclohexa-1,5-diene-1-carbohydrazide is sourced from PubChem (CID 67488433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).