C31H29N3O2 — CID 67490039
2-[3,5-bis(phenylmethoxy)phenyl]-6-pent-1-en-2-yl-1H-imidazo[4,5-b]pyridine (PubChem CID 67490039) has the molecular formula C31H29N3O2 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-[3,5-bis(phenylmethoxy)phenyl]-6-pent-1-en-2-yl-1H-imidazo[4,5-b]pyridine.
| Compound Name | 2-[3,5-bis(phenylmethoxy)phenyl]-6-pent-1-en-2-yl-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 67490039 |
| Molecular Formula | C31H29N3O2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 2-[3,5-bis(phenylmethoxy)phenyl]-6-pent-1-en-2-yl-1H-imidazo[4,5-b]pyridine |
| SMILES | C=C(CCC)c1cnc2nc(-c3cc(OCc4ccccc4)cc(OCc4ccccc4)c3)[nH]c2c1 |
| InChI | InChI=1S/C31H29N3O2/c1-3-10-22(2)26-17-29-31(32-19-26)34-30(33-29)25-15-27(35-20-23-11-6-4-7-12-23)18-28(16-25)36-21-24-13-8-5-9-14-24/h4-9,11-19H,2-3,10,20-21H2,1H3,(H,32,33,34) |
| InChIKey | NCGVQUJYBJZULQ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |